C10H14BrCl2FN2O2S — CID 120708578
N-(3-aminobutyl)-4-bromo-5-chloro-2-fluorobenzenesulfonamide;hydrochloride (PubChem CID 120708578) has the molecular formula C10H14BrCl2FN2O2S and a molecular weight of 396.11 g/mol. Its IUPAC name is N-(3-aminobutyl)-4-bromo-5-chloro-2-fluorobenzenesulfonamide;hydrochloride.
| Compound Name | N-(3-aminobutyl)-4-bromo-5-chloro-2-fluorobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120708578 |
| Molecular Formula | C10H14BrCl2FN2O2S |
| Molecular Weight | 396.11 g/mol |
| Exact Mass | 393.93 |
| IUPAC Name | N-(3-aminobutyl)-4-bromo-5-chloro-2-fluorobenzenesulfonamide;hydrochloride |
| SMILES | CC(N)CCNS(=O)(=O)c1cc(Cl)c(Br)cc1F.Cl |
| InChI | InChI=1S/C10H13BrClFN2O2S.ClH/c1-6(14)2-3-15-18(16,17)10-5-8(12)7(11)4-9(10)13;/h4-6,15H,2-3,14H2,1H3;1H |
| InChIKey | GAPIBFHEOBOLGI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.11 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|