C12H21ClN2O4S — CID 119972364
N-(3-aminobutyl)-3,4-dimethoxybenzenesulfonamide;hydrochloride (PubChem CID 119972364) has the molecular formula C12H21ClN2O4S and a molecular weight of 324.83 g/mol. Its IUPAC name is N-(3-aminobutyl)-3,4-dimethoxybenzenesulfonamide;hydrochloride.
| Compound Name | N-(3-aminobutyl)-3,4-dimethoxybenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119972364 |
| Molecular Formula | C12H21ClN2O4S |
| Molecular Weight | 324.83 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | N-(3-aminobutyl)-3,4-dimethoxybenzenesulfonamide;hydrochloride |
| SMILES | COc1ccc(S(=O)(=O)NCCC(C)N)cc1OC.Cl |
| InChI | InChI=1S/C12H20N2O4S.ClH/c1-9(13)6-7-14-19(15,16)10-4-5-11(17-2)12(8-10)18-3;/h4-5,8-9,14H,6-7,13H2,1-3H3;1H |
| InChIKey | NUTGORZHYBBCTJ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.83 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |