C9H17ClN2O3S2 — CID 119972633
N-(3-aminobutyl)-3-methoxythiophene-2-sulfonamide;hydrochloride (PubChem CID 119972633) has the molecular formula C9H17ClN2O3S2 and a molecular weight of 300.83 g/mol. Its IUPAC name is N-(3-aminobutyl)-3-methoxythiophene-2-sulfonamide;hydrochloride.
| Compound Name | N-(3-aminobutyl)-3-methoxythiophene-2-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119972633 |
| Molecular Formula | C9H17ClN2O3S2 |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | N-(3-aminobutyl)-3-methoxythiophene-2-sulfonamide;hydrochloride |
| SMILES | COc1ccsc1S(=O)(=O)NCCC(C)N.Cl |
| InChI | InChI=1S/C9H16N2O3S2.ClH/c1-7(10)3-5-11-16(12,13)9-8(14-2)4-6-15-9;/h4,6-7,11H,3,5,10H2,1-2H3;1H |
| InChIKey | MLGWPUVDCOGYRA-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |