C12H20N2O3S — CID 55169894
N-(3-aminobutyl)-2-methoxy-5-methylbenzenesulfonamide (PubChem CID 55169894) has the molecular formula C12H20N2O3S and a molecular weight of 272.37 g/mol. Its IUPAC name is N-(3-aminobutyl)-2-methoxy-5-methylbenzenesulfonamide.
| Compound Name | N-(3-aminobutyl)-2-methoxy-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 55169894 |
| Molecular Formula | C12H20N2O3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | N-(3-aminobutyl)-2-methoxy-5-methylbenzenesulfonamide |
| SMILES | COc1ccc(C)cc1S(=O)(=O)NCCC(C)N |
| InChI | InChI=1S/C12H20N2O3S/c1-9-4-5-11(17-3)12(8-9)18(15,16)14-7-6-10(2)13/h4-5,8,10,14H,6-7,13H2,1-3H3 |
| InChIKey | VJTWPHXCFAWYRV-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |