C11H18N2O4S — CID 64928024
5-amino-N-(3-hydroxybutyl)-2-methoxybenzenesulfonamide (PubChem CID 64928024) has the molecular formula C11H18N2O4S and a molecular weight of 274.34 g/mol. Its IUPAC name is 5-amino-N-(3-hydroxybutyl)-2-methoxybenzenesulfonamide.
| Compound Name | 5-amino-N-(3-hydroxybutyl)-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 64928024 |
| Molecular Formula | C11H18N2O4S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 5-amino-N-(3-hydroxybutyl)-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(N)cc1S(=O)(=O)NCCC(C)O |
| InChI | InChI=1S/C11H18N2O4S/c1-8(14)5-6-13-18(15,16)11-7-9(12)3-4-10(11)17-2/h3-4,7-8,13-14H,5-6,12H2,1-2H3 |
| InChIKey | MXBOSMQQUZNODT-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|