C12H20N2O5S — CID 106242625
5-amino-N-(3-hydroxy-4-methoxybutyl)-2-methoxybenzenesulfonamide (PubChem CID 106242625) has the molecular formula C12H20N2O5S and a molecular weight of 304.37 g/mol. Its IUPAC name is 5-amino-N-(3-hydroxy-4-methoxybutyl)-2-methoxybenzenesulfonamide.
| Compound Name | 5-amino-N-(3-hydroxy-4-methoxybutyl)-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 106242625 |
| Molecular Formula | C12H20N2O5S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 5-amino-N-(3-hydroxy-4-methoxybutyl)-2-methoxybenzenesulfonamide |
| SMILES | COCC(O)CCNS(=O)(=O)c1cc(N)ccc1OC |
| InChI | InChI=1S/C12H20N2O5S/c1-18-8-10(15)5-6-14-20(16,17)12-7-9(13)3-4-11(12)19-2/h3-4,7,10,14-15H,5-6,8,13H2,1-2H3 |
| InChIKey | KXRKJFXQJUKFLL-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|