C12H18N2O6S — CID 106242569
5-amino-2-[(3-hydroxy-4-methoxybutyl)sulfamoyl]benzoic acid (PubChem CID 106242569) has the molecular formula C12H18N2O6S and a molecular weight of 318.35 g/mol. Its IUPAC name is 5-amino-2-[(3-hydroxy-4-methoxybutyl)sulfamoyl]benzoic acid.
| Compound Name | 5-amino-2-[(3-hydroxy-4-methoxybutyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 106242569 |
| Molecular Formula | C12H18N2O6S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 5-amino-2-[(3-hydroxy-4-methoxybutyl)sulfamoyl]benzoic acid |
| SMILES | COCC(O)CCNS(=O)(=O)c1ccc(N)cc1C(=O)O |
| InChI | InChI=1S/C12H18N2O6S/c1-20-7-9(15)4-5-14-21(18,19)11-3-2-8(13)6-10(11)12(16)17/h2-3,6,9,14-15H,4-5,7,13H2,1H3,(H,16,17) |
| InChIKey | VUBVHPBPGZWRMY-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|