C9H13Cl2NO4S2 — CID 113343427
2,5-dichloro-N-(3-hydroxy-4-methoxybutyl)thiophene-3-sulfonamide (PubChem CID 113343427) has the molecular formula C9H13Cl2NO4S2 and a molecular weight of 334.25 g/mol. Its IUPAC name is 2,5-dichloro-N-(3-hydroxy-4-methoxybutyl)thiophene-3-sulfonamide.
| Compound Name | 2,5-dichloro-N-(3-hydroxy-4-methoxybutyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 113343427 |
| Molecular Formula | C9H13Cl2NO4S2 |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 332.97 |
| IUPAC Name | 2,5-dichloro-N-(3-hydroxy-4-methoxybutyl)thiophene-3-sulfonamide |
| SMILES | COCC(O)CCNS(=O)(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C9H13Cl2NO4S2/c1-16-5-6(13)2-3-12-18(14,15)7-4-8(10)17-9(7)11/h4,6,12-13H,2-3,5H2,1H3 |
| InChIKey | GBXYJNPAHASCRE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |