C9H12Cl3NO3S2 — CID 114163439
2,5-dichloro-N-(3-chloro-4-methoxybutyl)thiophene-3-sulfonamide (PubChem CID 114163439) has the molecular formula C9H12Cl3NO3S2 and a molecular weight of 352.69 g/mol. Its IUPAC name is 2,5-dichloro-N-(3-chloro-4-methoxybutyl)thiophene-3-sulfonamide.
| Compound Name | 2,5-dichloro-N-(3-chloro-4-methoxybutyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 114163439 |
| Molecular Formula | C9H12Cl3NO3S2 |
| Molecular Weight | 352.69 g/mol |
| Exact Mass | 350.93 |
| IUPAC Name | 2,5-dichloro-N-(3-chloro-4-methoxybutyl)thiophene-3-sulfonamide |
| SMILES | COCC(Cl)CCNS(=O)(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C9H12Cl3NO3S2/c1-16-5-6(10)2-3-13-18(14,15)7-4-8(11)17-9(7)12/h4,6,13H,2-3,5H2,1H3 |
| InChIKey | UPRRJQUVANQWKT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.69 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|