C8H10BrCl2NO3S2 — CID 114296020
N-[2-(2-bromoethoxy)ethyl]-2,5-dichlorothiophene-3-sulfonamide (PubChem CID 114296020) has the molecular formula C8H10BrCl2NO3S2 and a molecular weight of 383.12 g/mol. Its IUPAC name is N-[2-(2-bromoethoxy)ethyl]-2,5-dichlorothiophene-3-sulfonamide.
| Compound Name | N-[2-(2-bromoethoxy)ethyl]-2,5-dichlorothiophene-3-sulfonamide |
|---|---|
| PubChem CID | 114296020 |
| Molecular Formula | C8H10BrCl2NO3S2 |
| Molecular Weight | 383.12 g/mol |
| Exact Mass | 380.87 |
| IUPAC Name | N-[2-(2-bromoethoxy)ethyl]-2,5-dichlorothiophene-3-sulfonamide |
| SMILES | O=S(=O)(NCCOCCBr)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C8H10BrCl2NO3S2/c9-1-3-15-4-2-12-17(13,14)6-5-7(10)16-8(6)11/h5,12H,1-4H2 |
| InChIKey | OXYZFMGIFFICBA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.12 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|