C7H10Cl2N2O2S2 — CID 43167116
N-(3-aminopropyl)-2,5-dichlorothiophene-3-sulfonamide (PubChem CID 43167116) has the molecular formula C7H10Cl2N2O2S2 and a molecular weight of 289.21 g/mol. Its IUPAC name is N-(3-aminopropyl)-2,5-dichlorothiophene-3-sulfonamide.
| Compound Name | N-(3-aminopropyl)-2,5-dichlorothiophene-3-sulfonamide |
|---|---|
| PubChem CID | 43167116 |
| Molecular Formula | C7H10Cl2N2O2S2 |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 287.96 |
| IUPAC Name | N-(3-aminopropyl)-2,5-dichlorothiophene-3-sulfonamide |
| SMILES | NCCCNS(=O)(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C7H10Cl2N2O2S2/c8-6-4-5(7(9)14-6)15(12,13)11-3-1-2-10/h4,11H,1-3,10H2 |
| InChIKey | HDFMCZGXPHXHLX-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|