C12H12Cl2N2O4S3 — CID 39792284
2,5-dichloro-N-[2-(4-sulfamoylphenyl)ethyl]thiophene-3-sulfonamide (PubChem CID 39792284) has the molecular formula C12H12Cl2N2O4S3 and a molecular weight of 415.35 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-(4-sulfamoylphenyl)ethyl]thiophene-3-sulfonamide.
| Compound Name | 2,5-dichloro-N-[2-(4-sulfamoylphenyl)ethyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 39792284 |
| Molecular Formula | C12H12Cl2N2O4S3 |
| Molecular Weight | 415.35 g/mol |
| Exact Mass | 413.93 |
| IUPAC Name | 2,5-dichloro-N-[2-(4-sulfamoylphenyl)ethyl]thiophene-3-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCNS(=O)(=O)c2cc(Cl)sc2Cl)cc1 |
| InChI | InChI=1S/C12H12Cl2N2O4S3/c13-11-7-10(12(14)21-11)23(19,20)16-6-5-8-1-3-9(4-2-8)22(15,17)18/h1-4,7,16H,5-6H2,(H2,15,17,18) |
| InChIKey | NHGGRPDHJOMETR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |