C14H15BrN2O4S2 — CID 2551997
3-bromo-N-[2-(4-sulfamoylphenyl)ethyl]benzenesulfonamide (PubChem CID 2551997) has the molecular formula C14H15BrN2O4S2 and a molecular weight of 419.32 g/mol. Its IUPAC name is 3-bromo-N-[2-(4-sulfamoylphenyl)ethyl]benzenesulfonamide.
| Compound Name | 3-bromo-N-[2-(4-sulfamoylphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2551997 |
| Molecular Formula | C14H15BrN2O4S2 |
| Molecular Weight | 419.32 g/mol |
| Exact Mass | 417.97 |
| IUPAC Name | 3-bromo-N-[2-(4-sulfamoylphenyl)ethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCNS(=O)(=O)c2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C14H15BrN2O4S2/c15-12-2-1-3-14(10-12)23(20,21)17-9-8-11-4-6-13(7-5-11)22(16,18)19/h1-7,10,17H,8-9H2,(H2,16,18,19) |
| InChIKey | OAKVMCWNLKSGDI-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |