C14H15N3O6S2 — CID 2952489
3-nitro-N-[2-(4-sulfamoylphenyl)ethyl]benzenesulfonamide (PubChem CID 2952489) has the molecular formula C14H15N3O6S2 and a molecular weight of 385.42 g/mol. Its IUPAC name is 3-nitro-N-[2-(4-sulfamoylphenyl)ethyl]benzenesulfonamide.
| Compound Name | 3-nitro-N-[2-(4-sulfamoylphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2952489 |
| Molecular Formula | C14H15N3O6S2 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | 3-nitro-N-[2-(4-sulfamoylphenyl)ethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCNS(=O)(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C14H15N3O6S2/c15-24(20,21)13-6-4-11(5-7-13)8-9-16-25(22,23)14-3-1-2-12(10-14)17(18)19/h1-7,10,16H,8-9H2,(H2,15,20,21) |
| InChIKey | PXPKAMHNNMNVRE-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 149.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|