C12H15N5O4S — CID 173212323
3-aminopropanenitrile;N-(2-cyanoethyl)-3-nitrobenzenesulfonamide (PubChem CID 173212323) has the molecular formula C12H15N5O4S and a molecular weight of 325.35 g/mol. Its IUPAC name is 3-aminopropanenitrile;N-(2-cyanoethyl)-3-nitrobenzenesulfonamide.
| Compound Name | 3-aminopropanenitrile;N-(2-cyanoethyl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 173212323 |
| Molecular Formula | C12H15N5O4S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 3-aminopropanenitrile;N-(2-cyanoethyl)-3-nitrobenzenesulfonamide |
| SMILES | N#CCCN.N#CCCNS(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H9N3O4S.C3H6N2/c10-5-2-6-11-17(15,16)9-4-1-3-8(7-9)12(13)14;4-2-1-3-5/h1,3-4,7,11H,2,6H2;1-2,4H2 |
| InChIKey | WNGZBSUQHUYWHN-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 162.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|