C14H13N5O4S — CID 133269912
N-[2-[(5-cyano-2-pyridinyl)amino]ethyl]-3-nitrobenzenesulfonamide (PubChem CID 133269912) has the molecular formula C14H13N5O4S and a molecular weight of 347.36 g/mol. Its IUPAC name is N-[2-[(5-cyano-2-pyridinyl)amino]ethyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-[2-[(5-cyano-2-pyridinyl)amino]ethyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 133269912 |
| Molecular Formula | C14H13N5O4S |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | N-[2-[(5-cyano-2-pyridinyl)amino]ethyl]-3-nitrobenzenesulfonamide |
| SMILES | N#Cc1ccc(NCCNS(=O)(=O)c2cccc([N+](=O)[O-])c2)nc1 |
| InChI | InChI=1S/C14H13N5O4S/c15-9-11-4-5-14(17-10-11)16-6-7-18-24(22,23)13-3-1-2-12(8-13)19(20)21/h1-5,8,10,18H,6-7H2,(H,16,17) |
| InChIKey | RHHIIHIXSDVEEO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 138.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|