C15H16N2O6S — CID 2900733
N-[2-(4-methoxyphenoxy)ethyl]-3-nitrobenzenesulfonamide (PubChem CID 2900733) has the molecular formula C15H16N2O6S and a molecular weight of 352.37 g/mol. Its IUPAC name is N-[2-(4-methoxyphenoxy)ethyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-[2-(4-methoxyphenoxy)ethyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 2900733 |
| Molecular Formula | C15H16N2O6S |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | N-[2-(4-methoxyphenoxy)ethyl]-3-nitrobenzenesulfonamide |
| SMILES | COc1ccc(OCCNS(=O)(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C15H16N2O6S/c1-22-13-5-7-14(8-6-13)23-10-9-16-24(20,21)15-4-2-3-12(11-15)17(18)19/h2-8,11,16H,9-10H2,1H3 |
| InChIKey | YIWWUFILXSPOHM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|