C17H15N3O6S — CID 110324856
N-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-nitrobenzenesulfonamide (PubChem CID 110324856) has the molecular formula C17H15N3O6S and a molecular weight of 389.39 g/mol. Its IUPAC name is N-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 110324856 |
| Molecular Formula | C17H15N3O6S |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | N-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-nitrobenzenesulfonamide |
| SMILES | COc1ccc2cc(CNS(=O)(=O)c3cccc([N+](=O)[O-])c3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C17H15N3O6S/c1-26-14-6-5-11-7-12(17(21)19-16(11)9-14)10-18-27(24,25)15-4-2-3-13(8-15)20(22)23/h2-9,18H,10H2,1H3,(H,19,21) |
| InChIKey | HQJCOEGEYDUNDJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 131.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|