C21H21N3O5 — CID 4020279
N-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-nitro-N-propylbenzamide (PubChem CID 4020279) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is N-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-nitro-N-propylbenzamide.
| Compound Name | N-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-nitro-N-propylbenzamide |
|---|---|
| PubChem CID | 4020279 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | N-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-nitro-N-propylbenzamide |
| SMILES | CCCN(Cc1cc2ccc(OC)cc2[nH]c1=O)C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H21N3O5/c1-3-9-23(21(26)15-5-4-6-17(11-15)24(27)28)13-16-10-14-7-8-18(29-2)12-19(14)22-20(16)25/h4-8,10-12H,3,9,13H2,1-2H3,(H,22,25) |
| InChIKey | SOHVBFKXYZLUIJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 105.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|