C24H28N2O4 — CID 3932848
N-butyl-N-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-2-(4-methoxyphenyl)acetamide (PubChem CID 3932848) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is N-butyl-N-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-butyl-N-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 3932848 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | N-butyl-N-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-2-(4-methoxyphenyl)acetamide |
| SMILES | CCCCN(Cc1cc2ccc(OC)cc2[nH]c1=O)C(=O)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C24H28N2O4/c1-4-5-12-26(23(27)13-17-6-9-20(29-2)10-7-17)16-19-14-18-8-11-21(30-3)15-22(18)25-24(19)28/h6-11,14-15H,4-5,12-13,16H2,1-3H3,(H,25,28) |
| InChIKey | MRHGJUVHUBWLRV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |