C21H22FN3O4 — CID 5014815
3-(4-fluorophenyl)-1-(3-hydroxypropyl)-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]urea (PubChem CID 5014815) has the molecular formula C21H22FN3O4 and a molecular weight of 399.42 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-(3-hydroxypropyl)-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]urea.
| Compound Name | 3-(4-fluorophenyl)-1-(3-hydroxypropyl)-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]urea |
|---|---|
| PubChem CID | 5014815 |
| Molecular Formula | C21H22FN3O4 |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 3-(4-fluorophenyl)-1-(3-hydroxypropyl)-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]urea |
| SMILES | COc1ccc2cc(CN(CCCO)C(=O)Nc3ccc(F)cc3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C21H22FN3O4/c1-29-18-8-3-14-11-15(20(27)24-19(14)12-18)13-25(9-2-10-26)21(28)23-17-6-4-16(22)5-7-17/h3-8,11-12,26H,2,9-10,13H2,1H3,(H,23,28)(H,24,27) |
| InChIKey | GEGBHQMFANAXPJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |