C26H24FN3O3S — CID 3173921
3-(4-fluorophenyl)-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-methoxyphenyl)methyl]thiourea (PubChem CID 3173921) has the molecular formula C26H24FN3O3S and a molecular weight of 477.56 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-methoxyphenyl)methyl]thiourea.
| Compound Name | 3-(4-fluorophenyl)-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-methoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 3173921 |
| Molecular Formula | C26H24FN3O3S |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 3-(4-fluorophenyl)-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-methoxyphenyl)methyl]thiourea |
| SMILES | COc1ccc(CN(Cc2cc3cc(OC)ccc3[nH]c2=O)C(=S)Nc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C26H24FN3O3S/c1-32-22-9-3-17(4-10-22)15-30(26(34)28-21-7-5-20(27)6-8-21)16-19-13-18-14-23(33-2)11-12-24(18)29-25(19)31/h3-14H,15-16H2,1-2H3,(H,28,34)(H,29,31) |
| InChIKey | BWBZQWJDWUIRCH-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|