C23H26FN3O3S — CID 3172358
1-[(4-fluorophenyl)methyl]-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-methoxypropyl)thiourea (PubChem CID 3172358) has the molecular formula C23H26FN3O3S and a molecular weight of 443.54 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-methoxypropyl)thiourea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-methoxypropyl)thiourea |
|---|---|
| PubChem CID | 3172358 |
| Molecular Formula | C23H26FN3O3S |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-methoxypropyl)thiourea |
| SMILES | COCCCNC(=S)N(Cc1ccc(F)cc1)Cc1cc2cc(OC)ccc2[nH]c1=O |
| InChI | InChI=1S/C23H26FN3O3S/c1-29-11-3-10-25-23(31)27(14-16-4-6-19(24)7-5-16)15-18-12-17-13-20(30-2)8-9-21(17)26-22(18)28/h4-9,12-13H,3,10-11,14-15H2,1-2H3,(H,25,31)(H,26,28) |
| InChIKey | RGBMQUKEIPRKEQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|