C23H26FN3O2S — CID 1375121
1-[(4-fluorophenyl)methyl]-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-methylpropyl)thiourea (PubChem CID 1375121) has the molecular formula C23H26FN3O2S and a molecular weight of 427.55 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-methylpropyl)thiourea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-methylpropyl)thiourea |
|---|---|
| PubChem CID | 1375121 |
| Molecular Formula | C23H26FN3O2S |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-methylpropyl)thiourea |
| SMILES | COc1ccc2[nH]c(=O)c(CN(Cc3ccc(F)cc3)C(=S)NCC(C)C)cc2c1 |
| InChI | InChI=1S/C23H26FN3O2S/c1-15(2)12-25-23(30)27(13-16-4-6-19(24)7-5-16)14-18-10-17-11-20(29-3)8-9-21(17)26-22(18)28/h4-11,15H,12-14H2,1-3H3,(H,25,30)(H,26,28) |
| InChIKey | IOOBCEAEULRHPA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|