C22H31N3O2S — CID 1137790
1-cyclohexyl-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-methylpropyl)thiourea (PubChem CID 1137790) has the molecular formula C22H31N3O2S and a molecular weight of 401.58 g/mol. Its IUPAC name is 1-cyclohexyl-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-methylpropyl)thiourea.
| Compound Name | 1-cyclohexyl-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-methylpropyl)thiourea |
|---|---|
| PubChem CID | 1137790 |
| Molecular Formula | C22H31N3O2S |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 1-cyclohexyl-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-methylpropyl)thiourea |
| SMILES | COc1ccc2[nH]c(=O)c(CN(C(=S)NCC(C)C)C3CCCCC3)cc2c1 |
| InChI | InChI=1S/C22H31N3O2S/c1-15(2)13-23-22(28)25(18-7-5-4-6-8-18)14-17-11-16-12-19(27-3)9-10-20(16)24-21(17)26/h9-12,15,18H,4-8,13-14H2,1-3H3,(H,23,28)(H,24,26) |
| InChIKey | UDNKKDRDCPDDAS-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|