C22H31N3O3S — CID 1149754
1-cyclopentyl-1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-methylpropyl)thiourea (PubChem CID 1149754) has the molecular formula C22H31N3O3S and a molecular weight of 417.58 g/mol. Its IUPAC name is 1-cyclopentyl-1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-methylpropyl)thiourea.
| Compound Name | 1-cyclopentyl-1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-methylpropyl)thiourea |
|---|---|
| PubChem CID | 1149754 |
| Molecular Formula | C22H31N3O3S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 1-cyclopentyl-1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-methylpropyl)thiourea |
| SMILES | COc1cc2cc(CN(C(=S)NCC(C)C)C3CCCC3)c(=O)[nH]c2cc1OC |
| InChI | InChI=1S/C22H31N3O3S/c1-14(2)12-23-22(29)25(17-7-5-6-8-17)13-16-9-15-10-19(27-3)20(28-4)11-18(15)24-21(16)26/h9-11,14,17H,5-8,12-13H2,1-4H3,(H,23,29)(H,24,26) |
| InChIKey | YNOUPIRYKBQVTK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|