C23H33N3O2S — CID 3171911
1-cyclohexyl-1-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-methoxypropyl)thiourea (PubChem CID 3171911) has the molecular formula C23H33N3O2S and a molecular weight of 415.60 g/mol. Its IUPAC name is 1-cyclohexyl-1-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-methoxypropyl)thiourea.
| Compound Name | 1-cyclohexyl-1-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-methoxypropyl)thiourea |
|---|---|
| PubChem CID | 3171911 |
| Molecular Formula | C23H33N3O2S |
| Molecular Weight | 415.60 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 1-cyclohexyl-1-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-methoxypropyl)thiourea |
| SMILES | COCCCNC(=S)N(Cc1cc2cc(C)c(C)cc2[nH]c1=O)C1CCCCC1 |
| InChI | InChI=1S/C23H33N3O2S/c1-16-12-18-14-19(22(27)25-21(18)13-17(16)2)15-26(20-8-5-4-6-9-20)23(29)24-10-7-11-28-3/h12-14,20H,4-11,15H2,1-3H3,(H,24,29)(H,25,27) |
| InChIKey | FJVDZNPCELULOC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.60 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|