C24H35N3O2S — CID 3177033
1-cyclohexyl-1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-ethoxypropyl)thiourea (PubChem CID 3177033) has the molecular formula C24H35N3O2S and a molecular weight of 429.63 g/mol. Its IUPAC name is 1-cyclohexyl-1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-ethoxypropyl)thiourea.
| Compound Name | 1-cyclohexyl-1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-ethoxypropyl)thiourea |
|---|---|
| PubChem CID | 3177033 |
| Molecular Formula | C24H35N3O2S |
| Molecular Weight | 429.63 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 1-cyclohexyl-1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-ethoxypropyl)thiourea |
| SMILES | CCOCCCNC(=S)N(Cc1cc2c(C)cc(C)cc2[nH]c1=O)C1CCCCC1 |
| InChI | InChI=1S/C24H35N3O2S/c1-4-29-12-8-11-25-24(30)27(20-9-6-5-7-10-20)16-19-15-21-18(3)13-17(2)14-22(21)26-23(19)28/h13-15,20H,4-12,16H2,1-3H3,(H,25,30)(H,26,28) |
| InChIKey | YYFBWDAULMDBCY-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.63 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|