C26H33N3O2S — CID 3184473
1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-ethoxypropyl)-1-[(4-methylphenyl)methyl]thiourea (PubChem CID 3184473) has the molecular formula C26H33N3O2S and a molecular weight of 451.64 g/mol. Its IUPAC name is 1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-ethoxypropyl)-1-[(4-methylphenyl)methyl]thiourea.
| Compound Name | 1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-ethoxypropyl)-1-[(4-methylphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 3184473 |
| Molecular Formula | C26H33N3O2S |
| Molecular Weight | 451.64 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-ethoxypropyl)-1-[(4-methylphenyl)methyl]thiourea |
| SMILES | CCOCCCNC(=S)N(Cc1ccc(C)cc1)Cc1cc2c(C)cc(C)cc2[nH]c1=O |
| InChI | InChI=1S/C26H33N3O2S/c1-5-31-12-6-11-27-26(32)29(16-21-9-7-18(2)8-10-21)17-22-15-23-20(4)13-19(3)14-24(23)28-25(22)30/h7-10,13-15H,5-6,11-12,16-17H2,1-4H3,(H,27,32)(H,28,30) |
| InChIKey | HRDNSYPXIPJJCC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.64 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|