C21H32N4O2S — CID 3171199
3-[3-(dimethylamino)propyl]-1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-hydroxypropyl)thiourea (PubChem CID 3171199) has the molecular formula C21H32N4O2S and a molecular weight of 404.58 g/mol. Its IUPAC name is 3-[3-(dimethylamino)propyl]-1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-hydroxypropyl)thiourea.
| Compound Name | 3-[3-(dimethylamino)propyl]-1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-hydroxypropyl)thiourea |
|---|---|
| PubChem CID | 3171199 |
| Molecular Formula | C21H32N4O2S |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 3-[3-(dimethylamino)propyl]-1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-hydroxypropyl)thiourea |
| SMILES | Cc1cc(C)c2cc(CN(CCCO)C(=S)NCCCN(C)C)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C21H32N4O2S/c1-15-11-16(2)18-13-17(20(27)23-19(18)12-15)14-25(9-6-10-26)21(28)22-7-5-8-24(3)4/h11-13,26H,5-10,14H2,1-4H3,(H,22,28)(H,23,27) |
| InChIKey | MAWSQJFXGWOLLR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 71.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|