C26H41N5O2S — CID 3171218
3-[3-(diethylamino)propyl]-1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ylethyl)thiourea (PubChem CID 3171218) has the molecular formula C26H41N5O2S and a molecular weight of 487.71 g/mol. Its IUPAC name is 3-[3-(diethylamino)propyl]-1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 3-[3-(diethylamino)propyl]-1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 3171218 |
| Molecular Formula | C26H41N5O2S |
| Molecular Weight | 487.71 g/mol |
| Exact Mass | 487.30 |
| IUPAC Name | 3-[3-(diethylamino)propyl]-1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ylethyl)thiourea |
| SMILES | CCN(CC)CCCNC(=S)N(CCN1CCOCC1)Cc1cc2c(C)cc(C)cc2[nH]c1=O |
| InChI | InChI=1S/C26H41N5O2S/c1-5-29(6-2)9-7-8-27-26(34)31(11-10-30-12-14-33-15-13-30)19-22-18-23-21(4)16-20(3)17-24(23)28-25(22)32/h16-18H,5-15,19H2,1-4H3,(H,27,34)(H,28,32) |
| InChIKey | QKRRVRFEKAEHGB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.71 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|