C25H39N5O2S — CID 3185875
1-[3-(dimethylamino)propyl]-1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 3185875) has the molecular formula C25H39N5O2S and a molecular weight of 473.69 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 1-[3-(dimethylamino)propyl]-1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 3185875 |
| Molecular Formula | C25H39N5O2S |
| Molecular Weight | 473.69 g/mol |
| Exact Mass | 473.28 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | Cc1cc(C)c2cc(CN(CCCN(C)C)C(=S)NCCCN3CCOCC3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C25H39N5O2S/c1-19-15-20(2)22-17-21(24(31)27-23(22)16-19)18-30(10-6-8-28(3)4)25(33)26-7-5-9-29-11-13-32-14-12-29/h15-17H,5-14,18H2,1-4H3,(H,26,33)(H,27,31) |
| InChIKey | VISGPHJYUYYXHT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.69 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|