C24H37N5O2S — CID 3171132
3-[3-(dimethylamino)propyl]-1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ylethyl)thiourea (PubChem CID 3171132) has the molecular formula C24H37N5O2S and a molecular weight of 459.66 g/mol. Its IUPAC name is 3-[3-(dimethylamino)propyl]-1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 3-[3-(dimethylamino)propyl]-1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 3171132 |
| Molecular Formula | C24H37N5O2S |
| Molecular Weight | 459.66 g/mol |
| Exact Mass | 459.27 |
| IUPAC Name | 3-[3-(dimethylamino)propyl]-1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ylethyl)thiourea |
| SMILES | Cc1ccc2cc(CN(CCN3CCOCC3)C(=S)NCCCN(C)C)c(=O)[nH]c2c1C |
| InChI | InChI=1S/C24H37N5O2S/c1-18-6-7-20-16-21(23(30)26-22(20)19(18)2)17-29(11-10-28-12-14-31-15-13-28)24(32)25-8-5-9-27(3)4/h6-7,16H,5,8-15,17H2,1-4H3,(H,25,32)(H,26,30) |
| InChIKey | BDEKDWDZZFSSAU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.66 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|