C25H36N4O2S — CID 3171167
1-cyclopentyl-1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 3171167) has the molecular formula C25H36N4O2S and a molecular weight of 456.66 g/mol. Its IUPAC name is 1-cyclopentyl-1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 1-cyclopentyl-1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 3171167 |
| Molecular Formula | C25H36N4O2S |
| Molecular Weight | 456.66 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | 1-cyclopentyl-1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | Cc1ccc2cc(CN(C(=S)NCCCN3CCOCC3)C3CCCC3)c(=O)[nH]c2c1C |
| InChI | InChI=1S/C25H36N4O2S/c1-18-8-9-20-16-21(24(30)27-23(20)19(18)2)17-29(22-6-3-4-7-22)25(32)26-10-5-11-28-12-14-31-15-13-28/h8-9,16,22H,3-7,10-15,17H2,1-2H3,(H,26,32)(H,27,30) |
| InChIKey | CZSCWUJCGDSCQV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.66 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|