C27H31N3O3S — CID 3174181
methyl 2-[[cyclohexyl-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]carbamothioyl]amino]benzoate (PubChem CID 3174181) has the molecular formula C27H31N3O3S and a molecular weight of 477.63 g/mol. Its IUPAC name is methyl 2-[[cyclohexyl-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]carbamothioyl]amino]benzoate.
| Compound Name | methyl 2-[[cyclohexyl-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]carbamothioyl]amino]benzoate |
|---|---|
| PubChem CID | 3174181 |
| Molecular Formula | C27H31N3O3S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | methyl 2-[[cyclohexyl-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]carbamothioyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=S)N(Cc1cc2ccc(C)c(C)c2[nH]c1=O)C1CCCCC1 |
| InChI | InChI=1S/C27H31N3O3S/c1-17-13-14-19-15-20(25(31)29-24(19)18(17)2)16-30(21-9-5-4-6-10-21)27(34)28-23-12-8-7-11-22(23)26(32)33-3/h7-8,11-15,21H,4-6,9-10,16H2,1-3H3,(H,28,34)(H,29,31) |
| InChIKey | KECLBPAYVGHTPD-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|