C27H26N4O3S — CID 3174165
methyl 2-[[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl-(pyridin-3-ylmethyl)carbamothioyl]amino]benzoate (PubChem CID 3174165) has the molecular formula C27H26N4O3S and a molecular weight of 486.60 g/mol. Its IUPAC name is methyl 2-[[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl-(pyridin-3-ylmethyl)carbamothioyl]amino]benzoate.
| Compound Name | methyl 2-[[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl-(pyridin-3-ylmethyl)carbamothioyl]amino]benzoate |
|---|---|
| PubChem CID | 3174165 |
| Molecular Formula | C27H26N4O3S |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | methyl 2-[[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl-(pyridin-3-ylmethyl)carbamothioyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=S)N(Cc1cccnc1)Cc1cc2ccc(C)c(C)c2[nH]c1=O |
| InChI | InChI=1S/C27H26N4O3S/c1-17-10-11-20-13-21(25(32)30-24(20)18(17)2)16-31(15-19-7-6-12-28-14-19)27(35)29-23-9-5-4-8-22(23)26(33)34-3/h4-14H,15-16H2,1-3H3,(H,29,35)(H,30,32) |
| InChIKey | JELYSCJNZKNIIA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|