C26H24N4O3S — CID 1141970
methyl 2-[[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl-(pyridin-3-ylmethyl)carbamothioyl]amino]benzoate (PubChem CID 1141970) has the molecular formula C26H24N4O3S and a molecular weight of 472.57 g/mol. Its IUPAC name is methyl 2-[[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl-(pyridin-3-ylmethyl)carbamothioyl]amino]benzoate.
| Compound Name | methyl 2-[[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl-(pyridin-3-ylmethyl)carbamothioyl]amino]benzoate |
|---|---|
| PubChem CID | 1141970 |
| Molecular Formula | C26H24N4O3S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | methyl 2-[[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl-(pyridin-3-ylmethyl)carbamothioyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=S)N(Cc1cccnc1)Cc1cc2cccc(C)c2[nH]c1=O |
| InChI | InChI=1S/C26H24N4O3S/c1-17-7-5-9-19-13-20(24(31)29-23(17)19)16-30(15-18-8-6-12-27-14-18)26(34)28-22-11-4-3-10-21(22)25(32)33-2/h3-14H,15-16H2,1-2H3,(H,28,34)(H,29,31) |
| InChIKey | MDONMFBBUSDQPO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|