C25H23FN4OS — CID 3171425
1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-fluorophenyl)-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 3171425) has the molecular formula C25H23FN4OS and a molecular weight of 446.55 g/mol. Its IUPAC name is 1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-fluorophenyl)-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-fluorophenyl)-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3171425 |
| Molecular Formula | C25H23FN4OS |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-fluorophenyl)-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | Cc1cc(C)c2[nH]c(=O)c(CN(Cc3cccnc3)C(=S)Nc3ccc(F)cc3)cc2c1 |
| InChI | InChI=1S/C25H23FN4OS/c1-16-10-17(2)23-19(11-16)12-20(24(31)29-23)15-30(14-18-4-3-9-27-13-18)25(32)28-22-7-5-21(26)6-8-22/h3-13H,14-15H2,1-2H3,(H,28,32)(H,29,31) |
| InChIKey | HQJNYOXGWNFVCH-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|