C25H23ClN4OS — CID 1136871
3-(3-chlorophenyl)-1-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 1136871) has the molecular formula C25H23ClN4OS and a molecular weight of 463.01 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 3-(3-chlorophenyl)-1-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 1136871 |
| Molecular Formula | C25H23ClN4OS |
| Molecular Weight | 463.01 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 3-(3-chlorophenyl)-1-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | Cc1cc2cc(CN(Cc3cccnc3)C(=S)Nc3cccc(Cl)c3)c(=O)[nH]c2cc1C |
| InChI | InChI=1S/C25H23ClN4OS/c1-16-9-19-11-20(24(31)29-23(19)10-17(16)2)15-30(14-18-5-4-8-27-13-18)25(32)28-22-7-3-6-21(26)12-22/h3-13H,14-15H2,1-2H3,(H,28,32)(H,29,31) |
| InChIKey | WLIOIDAHKZSZCT-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.01 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|