C25H22ClN3OS — CID 1140358
1-benzyl-3-(3-chlorophenyl)-1-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea (PubChem CID 1140358) has the molecular formula C25H22ClN3OS and a molecular weight of 447.99 g/mol. Its IUPAC name is 1-benzyl-3-(3-chlorophenyl)-1-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea.
| Compound Name | 1-benzyl-3-(3-chlorophenyl)-1-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
|---|---|
| PubChem CID | 1140358 |
| Molecular Formula | C25H22ClN3OS |
| Molecular Weight | 447.99 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 1-benzyl-3-(3-chlorophenyl)-1-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
| SMILES | Cc1ccc2cc(CN(Cc3ccccc3)C(=S)Nc3cccc(Cl)c3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C25H22ClN3OS/c1-17-10-11-19-13-20(24(30)28-23(19)12-17)16-29(15-18-6-3-2-4-7-18)25(31)27-22-9-5-8-21(26)14-22/h2-14H,15-16H2,1H3,(H,27,31)(H,28,30) |
| InChIKey | KEDJDKXXXRJFAI-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.99 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|