C27H25N3O3S — CID 1146293
1-benzyl-3-(3-methylphenyl)-1-[(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methyl]thiourea (PubChem CID 1146293) has the molecular formula C27H25N3O3S and a molecular weight of 471.58 g/mol. Its IUPAC name is 1-benzyl-3-(3-methylphenyl)-1-[(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methyl]thiourea.
| Compound Name | 1-benzyl-3-(3-methylphenyl)-1-[(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methyl]thiourea |
|---|---|
| PubChem CID | 1146293 |
| Molecular Formula | C27H25N3O3S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | 1-benzyl-3-(3-methylphenyl)-1-[(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methyl]thiourea |
| SMILES | Cc1cccc(NC(=S)N(Cc2ccccc2)Cc2cc3cc4c(cc3[nH]c2=O)OCCO4)c1 |
| InChI | InChI=1S/C27H25N3O3S/c1-18-6-5-9-22(12-18)28-27(34)30(16-19-7-3-2-4-8-19)17-21-13-20-14-24-25(33-11-10-32-24)15-23(20)29-26(21)31/h2-9,12-15H,10-11,16-17H2,1H3,(H,28,34)(H,29,31) |
| InChIKey | ODYXUSLXGWGOPK-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|