C25H28N4O4S — CID 1146419
1-(2-morpholin-4-ylethyl)-1-[(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methyl]-3-phenylthiourea (PubChem CID 1146419) has the molecular formula C25H28N4O4S and a molecular weight of 480.59 g/mol. Its IUPAC name is 1-(2-morpholin-4-ylethyl)-1-[(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methyl]-3-phenylthiourea.
| Compound Name | 1-(2-morpholin-4-ylethyl)-1-[(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 1146419 |
| Molecular Formula | C25H28N4O4S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 1-(2-morpholin-4-ylethyl)-1-[(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methyl]-3-phenylthiourea |
| SMILES | O=c1[nH]c2cc3c(cc2cc1CN(CCN1CCOCC1)C(=S)Nc1ccccc1)OCCO3 |
| InChI | InChI=1S/C25H28N4O4S/c30-24-19(14-18-15-22-23(16-21(18)27-24)33-13-12-32-22)17-29(7-6-28-8-10-31-11-9-28)25(34)26-20-4-2-1-3-5-20/h1-5,14-16H,6-13,17H2,(H,26,34)(H,27,30) |
| InChIKey | OFCVJGNOONMXHJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 79.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|