C26H23N3O3S — CID 1146285
1-benzyl-1-[(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methyl]-3-phenylthiourea (PubChem CID 1146285) has the molecular formula C26H23N3O3S and a molecular weight of 457.56 g/mol. Its IUPAC name is 1-benzyl-1-[(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methyl]-3-phenylthiourea.
| Compound Name | 1-benzyl-1-[(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 1146285 |
| Molecular Formula | C26H23N3O3S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 1-benzyl-1-[(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methyl]-3-phenylthiourea |
| SMILES | O=c1[nH]c2cc3c(cc2cc1CN(Cc1ccccc1)C(=S)Nc1ccccc1)OCCO3 |
| InChI | InChI=1S/C26H23N3O3S/c30-25-20(13-19-14-23-24(15-22(19)28-25)32-12-11-31-23)17-29(16-18-7-3-1-4-8-18)26(33)27-21-9-5-2-6-10-21/h1-10,13-15H,11-12,16-17H2,(H,27,33)(H,28,30) |
| InChIKey | WGBMGIJRGRNJAP-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|