C23H19N3O4S — CID 3175585
1-(furan-2-ylmethyl)-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-3-phenylthiourea (PubChem CID 3175585) has the molecular formula C23H19N3O4S and a molecular weight of 433.49 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-3-phenylthiourea.
| Compound Name | 1-(furan-2-ylmethyl)-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 3175585 |
| Molecular Formula | C23H19N3O4S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 1-(furan-2-ylmethyl)-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-3-phenylthiourea |
| SMILES | O=c1[nH]c2cc3c(cc2cc1CN(Cc1ccco1)C(=S)Nc1ccccc1)OCO3 |
| InChI | InChI=1S/C23H19N3O4S/c27-22-16(9-15-10-20-21(30-14-29-20)11-19(15)25-22)12-26(13-18-7-4-8-28-18)23(31)24-17-5-2-1-3-6-17/h1-11H,12-14H2,(H,24,31)(H,25,27) |
| InChIKey | ATKJORRSKPRGHP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|