C26H22FN3O3S — CID 3175821
3-benzyl-1-[(4-fluorophenyl)methyl]-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]thiourea (PubChem CID 3175821) has the molecular formula C26H22FN3O3S and a molecular weight of 475.55 g/mol. Its IUPAC name is 3-benzyl-1-[(4-fluorophenyl)methyl]-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]thiourea.
| Compound Name | 3-benzyl-1-[(4-fluorophenyl)methyl]-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]thiourea |
|---|---|
| PubChem CID | 3175821 |
| Molecular Formula | C26H22FN3O3S |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | 3-benzyl-1-[(4-fluorophenyl)methyl]-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]thiourea |
| SMILES | O=c1[nH]c2cc3c(cc2cc1CN(Cc1ccc(F)cc1)C(=S)NCc1ccccc1)OCO3 |
| InChI | InChI=1S/C26H22FN3O3S/c27-21-8-6-18(7-9-21)14-30(26(34)28-13-17-4-2-1-3-5-17)15-20-10-19-11-23-24(33-16-32-23)12-22(19)29-25(20)31/h1-12H,13-16H2,(H,28,34)(H,29,31) |
| InChIKey | FDVODYXZNNIJJN-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|