C22H23N3O4S — CID 3175648
1-(2-hydroxyethyl)-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-3-(2-phenylethyl)thiourea (PubChem CID 3175648) has the molecular formula C22H23N3O4S and a molecular weight of 425.51 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-3-(2-phenylethyl)thiourea.
| Compound Name | 1-(2-hydroxyethyl)-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-3-(2-phenylethyl)thiourea |
|---|---|
| PubChem CID | 3175648 |
| Molecular Formula | C22H23N3O4S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 1-(2-hydroxyethyl)-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-3-(2-phenylethyl)thiourea |
| SMILES | O=c1[nH]c2cc3c(cc2cc1CN(CCO)C(=S)NCCc1ccccc1)OCO3 |
| InChI | InChI=1S/C22H23N3O4S/c26-9-8-25(22(30)23-7-6-15-4-2-1-3-5-15)13-17-10-16-11-19-20(29-14-28-19)12-18(16)24-21(17)27/h1-5,10-12,26H,6-9,13-14H2,(H,23,30)(H,24,27) |
| InChIKey | NWWSBBSCKIZRKO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 86.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|