C19H25N3O5S — CID 3175676
1-(3-hydroxypropyl)-3-(3-methoxypropyl)-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]thiourea (PubChem CID 3175676) has the molecular formula C19H25N3O5S and a molecular weight of 407.49 g/mol. Its IUPAC name is 1-(3-hydroxypropyl)-3-(3-methoxypropyl)-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]thiourea.
| Compound Name | 1-(3-hydroxypropyl)-3-(3-methoxypropyl)-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]thiourea |
|---|---|
| PubChem CID | 3175676 |
| Molecular Formula | C19H25N3O5S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 1-(3-hydroxypropyl)-3-(3-methoxypropyl)-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]thiourea |
| SMILES | COCCCNC(=S)N(CCCO)Cc1cc2cc3c(cc2[nH]c1=O)OCO3 |
| InChI | InChI=1S/C19H25N3O5S/c1-25-7-2-4-20-19(28)22(5-3-6-23)11-14-8-13-9-16-17(27-12-26-16)10-15(13)21-18(14)24/h8-10,23H,2-7,11-12H2,1H3,(H,20,28)(H,21,24) |
| InChIKey | QIZRDEQSANGAKG-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 96.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|