C20H29N4O4S+ — CID 7116442
3-[[3-hydroxypropyl-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]carbamothioyl]amino]propyl-dimethylazanium (PubChem CID 7116442) has the molecular formula C20H29N4O4S+ and a molecular weight of 421.54 g/mol. Its IUPAC name is 3-[[3-hydroxypropyl-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]carbamothioyl]amino]propyl-dimethylazanium.
| Compound Name | 3-[[3-hydroxypropyl-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]carbamothioyl]amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 7116442 |
| Molecular Formula | C20H29N4O4S+ |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 3-[[3-hydroxypropyl-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]carbamothioyl]amino]propyl-dimethylazanium |
| SMILES | C[NH+](C)CCCNC(=S)N(CCCO)Cc1cc2cc3c(cc2[nH]c1=O)OCO3 |
| InChI | InChI=1S/C20H28N4O4S/c1-23(2)6-3-5-21-20(29)24(7-4-8-25)12-15-9-14-10-17-18(28-13-27-17)11-16(14)22-19(15)26/h9-11,25H,3-8,12-13H2,1-2H3,(H,21,29)(H,22,26)/p+1 |
| InChIKey | KGADZWFOWMWLOM-UHFFFAOYSA-O |
| XLogP | -0.15 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|