C21H32N4O3S — CID 3185827
1-[3-(dimethylamino)propyl]-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-methoxypropyl)thiourea (PubChem CID 3185827) has the molecular formula C21H32N4O3S and a molecular weight of 420.58 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-methoxypropyl)thiourea.
| Compound Name | 1-[3-(dimethylamino)propyl]-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-methoxypropyl)thiourea |
|---|---|
| PubChem CID | 3185827 |
| Molecular Formula | C21H32N4O3S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-methoxypropyl)thiourea |
| SMILES | COCCCNC(=S)N(CCCN(C)C)Cc1cc2ccc(OC)cc2[nH]c1=O |
| InChI | InChI=1S/C21H32N4O3S/c1-24(2)10-6-11-25(21(29)22-9-5-12-27-3)15-17-13-16-7-8-18(28-4)14-19(16)23-20(17)26/h7-8,13-14H,5-6,9-12,15H2,1-4H3,(H,22,29)(H,23,26) |
| InChIKey | UWJZFFUJDVQNOM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 69.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|