C23H37N5O2S — CID 3174091
1-[2-(diethylamino)ethyl]-3-[3-(dimethylamino)propyl]-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]thiourea (PubChem CID 3174091) has the molecular formula C23H37N5O2S and a molecular weight of 447.65 g/mol. Its IUPAC name is 1-[2-(diethylamino)ethyl]-3-[3-(dimethylamino)propyl]-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]thiourea.
| Compound Name | 1-[2-(diethylamino)ethyl]-3-[3-(dimethylamino)propyl]-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
|---|---|
| PubChem CID | 3174091 |
| Molecular Formula | C23H37N5O2S |
| Molecular Weight | 447.65 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | 1-[2-(diethylamino)ethyl]-3-[3-(dimethylamino)propyl]-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
| SMILES | CCN(CC)CCN(Cc1cc2ccc(OC)cc2[nH]c1=O)C(=S)NCCCN(C)C |
| InChI | InChI=1S/C23H37N5O2S/c1-6-27(7-2)13-14-28(23(31)24-11-8-12-26(3)4)17-19-15-18-9-10-20(30-5)16-21(18)25-22(19)29/h9-10,15-16H,6-8,11-14,17H2,1-5H3,(H,24,31)(H,25,29) |
| InChIKey | AGFXKNLMOIXYHF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.65 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|